About 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate
2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate (PubChem CID 146611869) has the molecular formula C17H31NO7
and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate.
Molecular Properties
| Compound Name | 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate |
| PubChem CID | 146611869 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate |
| SMILES | CCC(=O)COC(=O)C(C)(N)OCCC(C)(C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO7/c1-8-12(19)11-22-13(20)17(7,18)23-10-9-16(5,6)25-14(21)24-15(2,3)4/h8-11,18H2,1-7H3 |
| InChIKey | RVCZKROCUXMDEH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate?
The IUPAC name of 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate (CID 146611869) is 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate.
What is the SMILES notation for 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate?
The canonical SMILES for 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate is CCC(=O)COC(=O)C(C)(N)OCCC(C)(C)OC(=O)OC(C)(C)C.
What is the InChIKey of 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate?
The InChIKey is RVCZKROCUXMDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO7/c1-8-12(19)11-22-13(20)17(7,18)23-10-9-16(5,6)25-14(21)24-15(2,3)4/h8-11,18H2,1-7H3.
What are the key properties of 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate?
2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate has a molecular weight of 361.44 g/mol, XLogP of 2.32, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxobutyl 2-amino-2-[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]butoxy]propanoate is sourced from PubChem (CID 146611869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).