C16H22O2 — CID 146612512
(3-methylcyclohex-2-en-1-yl) (3Z,4Z)-3-ethylidenehepta-4,6-dienoate (PubChem CID 146612512) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3-methylcyclohex-2-en-1-yl) (3Z,4Z)-3-ethylidenehepta-4,6-dienoate.
| Compound Name | (3-methylcyclohex-2-en-1-yl) (3Z,4Z)-3-ethylidenehepta-4,6-dienoate |
|---|---|
| PubChem CID | 146612512 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3-methylcyclohex-2-en-1-yl) (3Z,4Z)-3-ethylidenehepta-4,6-dienoate |
| SMILES | C=C/C=C\C(=C/C)CC(=O)OC1C=C(C)CCC1 |
| InChI | InChI=1S/C16H22O2/c1-4-6-9-14(5-2)12-16(17)18-15-10-7-8-13(3)11-15/h4-6,9,11,15H,1,7-8,10,12H2,2-3H3/b9-6-,14-5+ |
| InChIKey | HXHCGBIHXRSZSD-WSHVSDRZSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|