C17H14ClFN4O2 — CID 146612664
1-(2-but-1-en-2-yl-4-methyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 146612664) has the molecular formula C17H14ClFN4O2 and a molecular weight of 360.78 g/mol. Its IUPAC name is 1-(2-but-1-en-2-yl-4-methyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(2-but-1-en-2-yl-4-methyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146612664 |
| Molecular Formula | C17H14ClFN4O2 |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-(2-but-1-en-2-yl-4-methyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | C=C(CC)c1nccc(C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C17H14ClFN4O2/c1-4-8(2)12-13(9(3)5-6-20-12)23-15-10(16(24)22-17(23)25)7-11(19)14(18)21-15/h5-7H,2,4H2,1,3H3,(H,22,24,25) |
| InChIKey | MKQXPYHHIQBDII-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|