About 5-pyridazin-3-yl-2,3-dihydrothiadiazole
5-pyridazin-3-yl-2,3-dihydrothiadiazole (PubChem CID 146613395) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 5-pyridazin-3-yl-2,3-dihydrothiadiazole.
Molecular Properties
| Compound Name | 5-pyridazin-3-yl-2,3-dihydrothiadiazole |
| PubChem CID | 146613395 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 5-pyridazin-3-yl-2,3-dihydrothiadiazole |
| SMILES | C1=C(c2cccnn2)SNN1 |
| InChI | InChI=1S/C6H6N4S/c1-2-5(9-7-3-1)6-4-8-10-11-6/h1-4,8,10H |
| InChIKey | FYTOPABIAGHPCA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-pyridazin-3-yl-2,3-dihydrothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridazin-3-yl-2,3-dihydrothiadiazole?
The IUPAC name of 5-pyridazin-3-yl-2,3-dihydrothiadiazole (CID 146613395) is 5-pyridazin-3-yl-2,3-dihydrothiadiazole.
What is the SMILES notation for 5-pyridazin-3-yl-2,3-dihydrothiadiazole?
The canonical SMILES for 5-pyridazin-3-yl-2,3-dihydrothiadiazole is C1=C(c2cccnn2)SNN1.
What is the InChIKey of 5-pyridazin-3-yl-2,3-dihydrothiadiazole?
The InChIKey is FYTOPABIAGHPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c1-2-5(9-7-3-1)6-4-8-10-11-6/h1-4,8,10H.
What are the key properties of 5-pyridazin-3-yl-2,3-dihydrothiadiazole?
5-pyridazin-3-yl-2,3-dihydrothiadiazole has a molecular weight of 166.21 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridazin-3-yl-2,3-dihydrothiadiazole is sourced from PubChem (CID 146613395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).