C19H30N4O2S — CID 146613422
(3aS,6aR)-3a,6a-dimethyl-5-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 146613422) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is (3aS,6aR)-3a,6a-dimethyl-5-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-3a,6a-dimethyl-5-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 146613422 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (3aS,6aR)-3a,6a-dimethyl-5-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | C[C@@]12CNC[C@]1(C)CN(c1ccc(N3CCN(S(C)(=O)=O)CC3)cc1)C2 |
| InChI | InChI=1S/C19H30N4O2S/c1-18-12-20-13-19(18,2)15-22(14-18)17-6-4-16(5-7-17)21-8-10-23(11-9-21)26(3,24)25/h4-7,20H,8-15H2,1-3H3/t18-,19+ |
| InChIKey | XCINFMUPACQCLT-KDURUIRLSA-N |
| XLogP | 1.20 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|