C7H4F6O2 — CID 146613895
5,5,6,6,7,7-hexafluoro-2,3-dihydrocyclopenta[b][1,4]dioxine (PubChem CID 146613895) has the molecular formula C7H4F6O2 and a molecular weight of 234.09 g/mol. Its IUPAC name is 5,5,6,6,7,7-hexafluoro-2,3-dihydrocyclopenta[b][1,4]dioxine.
| Compound Name | 5,5,6,6,7,7-hexafluoro-2,3-dihydrocyclopenta[b][1,4]dioxine |
|---|---|
| PubChem CID | 146613895 |
| Molecular Formula | C7H4F6O2 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 5,5,6,6,7,7-hexafluoro-2,3-dihydrocyclopenta[b][1,4]dioxine |
| SMILES | FC1(F)C2=C(OCCO2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H4F6O2/c8-5(9)3-4(15-2-1-14-3)6(10,11)7(5,12)13/h1-2H2 |
| InChIKey | OBTKTZQIDGJECL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|