C6H6F9NO2S — CID 14661392
N-ethyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 14661392) has the molecular formula C6H6F9NO2S and a molecular weight of 327.17 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-ethyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 14661392 |
| Molecular Formula | C6H6F9NO2S |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-ethyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F9NO2S/c1-2-16-19(17,18)6(14,15)4(9,10)3(7,8)5(11,12)13/h16H,2H2,1H3 |
| InChIKey | SSTPSALUCQWOOV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|