C13H12IN3O — CID 146614109
(3E,5E)-2-(benzotriazol-2-yl)-6-iodohepta-1,3,5-trien-3-ol (PubChem CID 146614109) has the molecular formula C13H12IN3O and a molecular weight of 353.16 g/mol. Its IUPAC name is (3E,5E)-2-(benzotriazol-2-yl)-6-iodohepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-2-(benzotriazol-2-yl)-6-iodohepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 146614109 |
| Molecular Formula | C13H12IN3O |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | (3E,5E)-2-(benzotriazol-2-yl)-6-iodohepta-1,3,5-trien-3-ol |
| SMILES | C=C(/C(O)=C\C=C(/C)I)n1nc2ccccc2n1 |
| InChI | InChI=1S/C13H12IN3O/c1-9(14)7-8-13(18)10(2)17-15-11-5-3-4-6-12(11)16-17/h3-8,18H,2H2,1H3/b9-7+,13-8+ |
| InChIKey | BAOUDSJVXDHTBH-AVPQAVFTSA-N |
| XLogP | 3.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|