C32H44O8 — CID 146614218
3-[2,4-bis(methoxymethoxy)phenyl]-1-[2,4,6-trimethoxy-3-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)phenyl]propan-1-one (PubChem CID 146614218) has the molecular formula C32H44O8 and a molecular weight of 556.70 g/mol. Its IUPAC name is 3-[2,4-bis(methoxymethoxy)phenyl]-1-[2,4,6-trimethoxy-3-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)phenyl]propan-1-one.
| Compound Name | 3-[2,4-bis(methoxymethoxy)phenyl]-1-[2,4,6-trimethoxy-3-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 146614218 |
| Molecular Formula | C32H44O8 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 3-[2,4-bis(methoxymethoxy)phenyl]-1-[2,4,6-trimethoxy-3-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)phenyl]propan-1-one |
| SMILES | C=C(C)C(CC=C(C)C)Cc1c(OC)cc(OC)c(C(=O)CCc2ccc(OCOC)cc2OCOC)c1OC |
| InChI | InChI=1S/C32H44O8/c1-21(2)10-11-24(22(3)4)16-26-29(36-7)18-30(37-8)31(32(26)38-9)27(33)15-13-23-12-14-25(39-19-34-5)17-28(23)40-20-35-6/h10,12,14,17-18,24H,3,11,13,15-16,19-20H2,1-2,4-9H3 |
| InChIKey | WYULQUWKIMIOQR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|