C24H24ClN3O — CID 146614246
4-chloro-2-cyclopentyl-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one (PubChem CID 146614246) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 4-chloro-2-cyclopentyl-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 4-chloro-2-cyclopentyl-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146614246 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-chloro-2-cyclopentyl-5-methyl-6-[(4-pyrazol-1-ylphenyl)methyl]-3H-isoindol-1-one |
| SMILES | Cc1c(Cc2ccc(-n3cccn3)cc2)cc2c(c1Cl)CN(C1CCCC1)C2=O |
| InChI | InChI=1S/C24H24ClN3O/c1-16-18(13-17-7-9-20(10-8-17)28-12-4-11-26-28)14-21-22(23(16)25)15-27(24(21)29)19-5-2-3-6-19/h4,7-12,14,19H,2-3,5-6,13,15H2,1H3 |
| InChIKey | XWNFMOXCZWUOAV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |