C15H27N3S — CID 146614528
(2E,4Z)-N-(aminosulfanylmethyl)-2,4-dimethyl-N-pentylhepta-2,4,6-trienimidamide (PubChem CID 146614528) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is (2E,4Z)-N-(aminosulfanylmethyl)-2,4-dimethyl-N-pentylhepta-2,4,6-trienimidamide.
| Compound Name | (2E,4Z)-N-(aminosulfanylmethyl)-2,4-dimethyl-N-pentylhepta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 146614528 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | (2E,4Z)-N-(aminosulfanylmethyl)-2,4-dimethyl-N-pentylhepta-2,4,6-trienimidamide |
| SMILES | [H]/N=C(C(\C)=C\C(C)=C/C=C)/N(CCCCC)CSN |
| InChI | InChI=1S/C15H27N3S/c1-5-7-8-10-18(12-19-17)15(16)14(4)11-13(3)9-6-2/h6,9,11,16H,2,5,7-8,10,12,17H2,1,3-4H3/b13-9-,14-11+,16-15+ |
| InChIKey | UNJYPIDWYQEXPE-QATRVLTBSA-N |
| XLogP | 4.10 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|