About 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene
5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene (PubChem CID 146614842) has the molecular formula C12H15IO
and a molecular weight of 302.15 g/mol. Its IUPAC name is 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene |
| PubChem CID | 146614842 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene |
| SMILES | CC(C)c1ccc(I)c2c1OCCC2 |
| InChI | InChI=1S/C12H15IO/c1-8(2)9-5-6-11(13)10-4-3-7-14-12(9)10/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | UNHXJTSCDSYAGW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene?
The IUPAC name of 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene (CID 146614842) is 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene?
The canonical SMILES for 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene is CC(C)c1ccc(I)c2c1OCCC2.
What is the InChIKey of 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene?
The InChIKey is UNHXJTSCDSYAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IO/c1-8(2)9-5-6-11(13)10-4-3-7-14-12(9)10/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene?
5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene has a molecular weight of 302.15 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-8-propan-2-yl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 146614842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).