C15H20F5NO2 — CID 146614979
[2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]phenyl]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 146614979) has the molecular formula C15H20F5NO2 and a molecular weight of 341.32 g/mol. Its IUPAC name is [2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]phenyl]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]phenyl]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 146614979 |
| Molecular Formula | C15H20F5NO2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]phenyl]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC[C@@H](Nc1cc(F)c(C(O)OC(C)(C)C)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C15H20F5NO2/c1-5-11(15(18,19)20)21-8-6-9(16)12(10(17)7-8)13(22)23-14(2,3)4/h6-7,11,13,21-22H,5H2,1-4H3/t11-,13?/m1/s1 |
| InChIKey | QVTJIQLUELIHRS-JTDNENJMSA-N |
| XLogP | 4.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|