C30H23ClF2N4O5 — CID 146614995
(2S)-3-[8-(2-chloro-4-cyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(2-methoxyethylcarbamoyl)benzoyl]amino]propanoic acid (PubChem CID 146614995) has the molecular formula C30H23ClF2N4O5 and a molecular weight of 592.99 g/mol. Its IUPAC name is (2S)-3-[8-(2-chloro-4-cyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(2-methoxyethylcarbamoyl)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[8-(2-chloro-4-cyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(2-methoxyethylcarbamoyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146614995 |
| Molecular Formula | C30H23ClF2N4O5 |
| Molecular Weight | 592.99 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | (2S)-3-[8-(2-chloro-4-cyanophenyl)quinolin-5-yl]-2-[[2,6-difluoro-4-(2-methoxyethylcarbamoyl)benzoyl]amino]propanoic acid |
| SMILES | COCCNC(=O)c1cc(F)c(C(=O)N[C@@H](Cc2ccc(-c3ccc(C#N)cc3Cl)c3ncccc23)C(=O)O)c(F)c1 |
| InChI | InChI=1S/C30H23ClF2N4O5/c1-42-10-9-36-28(38)18-12-23(32)26(24(33)13-18)29(39)37-25(30(40)41)14-17-5-7-21(27-19(17)3-2-8-35-27)20-6-4-16(15-34)11-22(20)31/h2-8,11-13,25H,9-10,14H2,1H3,(H,36,38)(H,37,39)(H,40,41)/t25-/m0/s1 |
| InChIKey | PXOUAOFFYMLEEC-VWLOTQADSA-N |
| XLogP | 4.51 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|