C9H16F3NO — CID 146615373
(1S)-N-ethyl-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine (PubChem CID 146615373) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is (1S)-N-ethyl-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine.
| Compound Name | (1S)-N-ethyl-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 146615373 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (1S)-N-ethyl-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine |
| SMILES | CCN[C@@H](C1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-2-13-8(9(10,11)12)7-3-5-14-6-4-7/h7-8,13H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | JBYBDIDRMAWZDN-QMMMGPOBSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |