C34H34F5N3O6 — CID 146615525
(2S)-2-[[2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]benzoyl]amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid (PubChem CID 146615525) has the molecular formula C34H34F5N3O6 and a molecular weight of 675.65 g/mol. Its IUPAC name is (2S)-2-[[2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]benzoyl]amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid.
| Compound Name | (2S)-2-[[2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]benzoyl]amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 146615525 |
| Molecular Formula | C34H34F5N3O6 |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | (2S)-2-[[2,6-difluoro-4-[[(2R)-1,1,1-trifluorobutan-2-yl]amino]benzoyl]amino]-3-[8-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-5-yl]propanoic acid |
| SMILES | CCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)c3c(F)cc(N[C@H](CC)C(F)(F)F)cc3F)C(=O)O)c3cccnc23)c(OC)c1 |
| InChI | InChI=1S/C34H34F5N3O6/c1-5-28(34(37,38)39)41-20-15-23(35)30(24(36)16-20)32(43)42-25(33(44)45)14-19-9-10-22(31-21(19)8-7-11-40-31)29-26(46-3)12-18(17-48-6-2)13-27(29)47-4/h7-13,15-16,25,28,41H,5-6,14,17H2,1-4H3,(H,42,43)(H,44,45)/t25-,28+/m0/s1 |
| InChIKey | NFAWCFOUKRETGM-LBNVMWSVSA-N |
| XLogP | 6.91 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |