C26H41N3O — CID 146616100
N-[4-cyclooctyl-5-(methylamino)-6-[(Z)-prop-1-enyl]-3-pyridinyl]cyclooctanecarboxamide (PubChem CID 146616100) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is N-[4-cyclooctyl-5-(methylamino)-6-[(Z)-prop-1-enyl]-3-pyridinyl]cyclooctanecarboxamide.
| Compound Name | N-[4-cyclooctyl-5-(methylamino)-6-[(Z)-prop-1-enyl]-3-pyridinyl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 146616100 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | N-[4-cyclooctyl-5-(methylamino)-6-[(Z)-prop-1-enyl]-3-pyridinyl]cyclooctanecarboxamide |
| SMILES | C/C=C\c1ncc(NC(=O)C2CCCCCCC2)c(C2CCCCCCC2)c1NC |
| InChI | InChI=1S/C26H41N3O/c1-3-14-22-25(27-2)24(20-15-10-6-4-7-11-16-20)23(19-28-22)29-26(30)21-17-12-8-5-9-13-18-21/h3,14,19-21,27H,4-13,15-18H2,1-2H3,(H,29,30)/b14-3- |
| InChIKey | VEILQQJZGDCMDU-BNNQUZSASA-N |
| XLogP | 7.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |