C34H30N2O3 — CID 146616274
10-[2-(3-aminophenyl)ethynyl]-14-(2-ethylhexyl)-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione (PubChem CID 146616274) has the molecular formula C34H30N2O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 10-[2-(3-aminophenyl)ethynyl]-14-(2-ethylhexyl)-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 10-[2-(3-aminophenyl)ethynyl]-14-(2-ethylhexyl)-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 146616274 |
| Molecular Formula | C34H30N2O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 10-[2-(3-aminophenyl)ethynyl]-14-(2-ethylhexyl)-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-13,15-dione |
| SMILES | CCCCC(CC)Cn1c(=O)c2ccc3c4ccccc4oc4c(C#Cc5cccc(N)c5)cc(c1=O)c2c43 |
| InChI | InChI=1S/C34H30N2O3/c1-3-5-9-21(4-2)20-36-33(37)27-17-16-26-25-12-6-7-13-29(25)39-32-23(15-14-22-10-8-11-24(35)18-22)19-28(34(36)38)30(27)31(26)32/h6-8,10-13,16-19,21H,3-5,9,20,35H2,1-2H3 |
| InChIKey | AFGTYYBTTNMCOE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|