C21H25N5O3S — CID 146616364
2-[[5-(5,6-dihydro-[1,3]dioxolo[4,5-b]pyridin-6-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 146616364) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[[5-(5,6-dihydro-[1,3]dioxolo[4,5-b]pyridin-6-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[5-(5,6-dihydro-[1,3]dioxolo[4,5-b]pyridin-6-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 146616364 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[[5-(5,6-dihydro-[1,3]dioxolo[4,5-b]pyridin-6-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(C(C)C)cc2)nnc1C1C=C2OCOC2=NC1 |
| InChI | InChI=1S/C21H25N5O3S/c1-4-26-19(15-9-17-20(22-10-15)29-12-28-17)24-25-21(26)30-11-18(27)23-16-7-5-14(6-8-16)13(2)3/h5-9,13,15H,4,10-12H2,1-3H3,(H,23,27) |
| InChIKey | GRYBFRSPTBNZBP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |