C23H32N2 — CID 146616467
N-(3-cyclohepta-1,3,6-trien-1-yl-2-methylpropyl)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N'-methylethanimidamide (PubChem CID 146616467) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-(3-cyclohepta-1,3,6-trien-1-yl-2-methylpropyl)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N'-methylethanimidamide.
| Compound Name | N-(3-cyclohepta-1,3,6-trien-1-yl-2-methylpropyl)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 146616467 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N-(3-cyclohepta-1,3,6-trien-1-yl-2-methylpropyl)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N'-methylethanimidamide |
| SMILES | C=C/C(=C\C=C/C)C(=C)N(CC(C)CC1=CC=CCC=C1)/C(C)=N/C |
| InChI | InChI=1S/C23H32N2/c1-7-9-16-23(8-2)20(4)25(21(5)24-6)18-19(3)17-22-14-12-10-11-13-15-22/h7-10,12-16,19H,2,4,11,17-18H2,1,3,5-6H3/b9-7-,23-16+,24-21+ |
| InChIKey | JGRGTRMQHHGULR-UHXNJQBGSA-N |
| XLogP | 6.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|