C33H32N8O5S2 — CID 146616759
2-[[5-[5-[4-[[2-[[5-(2,3-dihydrofuran-3-yl)-4-formyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]phenyl]furan-3-yl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-2-methyl-N-phenylpropanamide (PubChem CID 146616759) has the molecular formula C33H32N8O5S2 and a molecular weight of 684.80 g/mol. Its IUPAC name is 2-[[5-[5-[4-[[2-[[5-(2,3-dihydrofuran-3-yl)-4-formyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]phenyl]furan-3-yl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-2-methyl-N-phenylpropanamide.
| Compound Name | 2-[[5-[5-[4-[[2-[[5-(2,3-dihydrofuran-3-yl)-4-formyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]phenyl]furan-3-yl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-2-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 146616759 |
| Molecular Formula | C33H32N8O5S2 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | 2-[[5-[5-[4-[[2-[[5-(2,3-dihydrofuran-3-yl)-4-formyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]phenyl]furan-3-yl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-2-methyl-N-phenylpropanamide |
| SMILES | CCn1c(SC(C)(C)C(=O)Nc2ccccc2)nnc1-c1coc(-c2ccc(NC(=O)CSc3nnc(C4C=COC4)n3C=O)cc2)c1 |
| InChI | InChI=1S/C33H32N8O5S2/c1-4-40-29(37-39-32(40)48-33(2,3)30(44)35-24-8-6-5-7-9-24)23-16-26(46-18-23)21-10-12-25(13-11-21)34-27(43)19-47-31-38-36-28(41(31)20-42)22-14-15-45-17-22/h5-16,18,20,22H,4,17,19H2,1-3H3,(H,34,43)(H,35,44) |
| InChIKey | JSCQKONYNLJMRN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|