C27H28N2O4 — CID 146616789
1-hydroxy-6-[3-hydroxy-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]pyridin-2-one (PubChem CID 146616789) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-hydroxy-6-[3-hydroxy-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]pyridin-2-one.
| Compound Name | 1-hydroxy-6-[3-hydroxy-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]pyridin-2-one |
|---|---|
| PubChem CID | 146616789 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-hydroxy-6-[3-hydroxy-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]pyridin-2-one |
| SMILES | O=c1cccc(CC(CO)c2ccc(C#Cc3ccc(CN4CCOCC4)cc3)cc2)n1O |
| InChI | InChI=1S/C27H28N2O4/c30-20-25(18-26-2-1-3-27(31)29(26)32)24-12-10-22(11-13-24)5-4-21-6-8-23(9-7-21)19-28-14-16-33-17-15-28/h1-3,6-13,25,30,32H,14-20H2 |
| InChIKey | ILQRREZCRHCGKJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|