C19H13ClO — CID 146616849
3-chloro-2-methyl-8-phenyldibenzofuran (PubChem CID 146616849) has the molecular formula C19H13ClO and a molecular weight of 292.76 g/mol. Its IUPAC name is 3-chloro-2-methyl-8-phenyldibenzofuran.
| Compound Name | 3-chloro-2-methyl-8-phenyldibenzofuran |
|---|---|
| PubChem CID | 146616849 |
| Molecular Formula | C19H13ClO |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-chloro-2-methyl-8-phenyldibenzofuran |
| SMILES | Cc1cc2c(cc1Cl)oc1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H13ClO/c1-12-9-15-16-10-14(13-5-3-2-4-6-13)7-8-18(16)21-19(15)11-17(12)20/h2-11H,1H3 |
| InChIKey | FKBCFNSKXPPGAN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |