C24H24ClN3S — CID 146617106
4-(4-chlorophenyl)-3-[(3E)-hepta-1,3-dien-3-yl]-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,2,4-triazole (PubChem CID 146617106) has the molecular formula C24H24ClN3S and a molecular weight of 422.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[(3E)-hepta-1,3-dien-3-yl]-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,2,4-triazole.
| Compound Name | 4-(4-chlorophenyl)-3-[(3E)-hepta-1,3-dien-3-yl]-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 146617106 |
| Molecular Formula | C24H24ClN3S |
| Molecular Weight | 422.00 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[(3E)-hepta-1,3-dien-3-yl]-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,2,4-triazole |
| SMILES | C=C/C(=C\CCC)c1nnc(SC/C=C/c2ccccc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3S/c1-3-5-13-20(4-2)23-26-27-24(28(23)22-16-14-21(25)15-17-22)29-18-9-12-19-10-7-6-8-11-19/h4,6-17H,2-3,5,18H2,1H3/b12-9+,20-13+ |
| InChIKey | WIZQBRLLVBXNLV-UKRUMFJESA-N |
| XLogP | 7.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.00 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|