C21H31F4N3O2 — CID 146617121
(2E,4Z,6E)-6-fluoro-4-methyl-N-[[1-[2-oxo-2-[(1,1,1-trifluoro-2-methylpropan-2-yl)amino]ethyl]piperidin-4-yl]methyl]octa-2,4,6-trienamide (PubChem CID 146617121) has the molecular formula C21H31F4N3O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is (2E,4Z,6E)-6-fluoro-4-methyl-N-[[1-[2-oxo-2-[(1,1,1-trifluoro-2-methylpropan-2-yl)amino]ethyl]piperidin-4-yl]methyl]octa-2,4,6-trienamide.
| Compound Name | (2E,4Z,6E)-6-fluoro-4-methyl-N-[[1-[2-oxo-2-[(1,1,1-trifluoro-2-methylpropan-2-yl)amino]ethyl]piperidin-4-yl]methyl]octa-2,4,6-trienamide |
|---|---|
| PubChem CID | 146617121 |
| Molecular Formula | C21H31F4N3O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (2E,4Z,6E)-6-fluoro-4-methyl-N-[[1-[2-oxo-2-[(1,1,1-trifluoro-2-methylpropan-2-yl)amino]ethyl]piperidin-4-yl]methyl]octa-2,4,6-trienamide |
| SMILES | C/C=C(F)\C=C(C)/C=C/C(=O)NCC1CCN(CC(=O)NC(C)(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H31F4N3O2/c1-5-17(22)12-15(2)6-7-18(29)26-13-16-8-10-28(11-9-16)14-19(30)27-20(3,4)21(23,24)25/h5-7,12,16H,8-11,13-14H2,1-4H3,(H,26,29)(H,27,30)/b7-6+,15-12-,17-5+ |
| InChIKey | ZRWZNGUJVBBHGA-MTHCPZAVSA-N |
| XLogP | 3.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|