C25H30O4 — CID 146617257
2-[[4-[4-[3-methyl-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]cyclohex-3-en-1-yl]phenoxy]methyl]oxirane (PubChem CID 146617257) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[[4-[4-[3-methyl-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]cyclohex-3-en-1-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[4-[3-methyl-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]cyclohex-3-en-1-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 146617257 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[[4-[4-[3-methyl-4-(oxiran-2-ylmethoxy)cyclohexa-2,4-dien-1-yl]cyclohex-3-en-1-yl]phenoxy]methyl]oxirane |
| SMILES | CC1=CC(C2=CCC(c3ccc(OCC4CO4)cc3)CC2)CC=C1OCC1CO1 |
| InChI | InChI=1S/C25H30O4/c1-17-12-21(8-11-25(17)29-16-24-15-28-24)20-4-2-18(3-5-20)19-6-9-22(10-7-19)26-13-23-14-27-23/h4,6-7,9-12,18,21,23-24H,2-3,5,8,13-16H2,1H3 |
| InChIKey | QVSRGABNROKUMO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|