About [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea
[[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea (PubChem CID 146617433) has the molecular formula C9H14FN3O3S2
and a molecular weight of 295.36 g/mol. Its IUPAC name is [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea.
Molecular Properties
| Compound Name | [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea |
| PubChem CID | 146617433 |
| Molecular Formula | C9H14FN3O3S2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea |
| SMILES | CNS(=O)(=NC(N)=O)c1sc(C(C)(C)O)cc1F |
| InChI | InChI=1S/C9H14FN3O3S2/c1-9(2,15)6-4-5(10)7(17-6)18(16,12-3)13-8(11)14/h4,15H,1-3H3,(H3,11,12,13,14,16) |
| InChIKey | UBVPKUWFJDQQTP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea?
The IUPAC name of [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea (CID 146617433) is [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea.
What is the SMILES notation for [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea?
The canonical SMILES for [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea is CNS(=O)(=NC(N)=O)c1sc(C(C)(C)O)cc1F.
What is the InChIKey of [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea?
The InChIKey is UBVPKUWFJDQQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O3S2/c1-9(2,15)6-4-5(10)7(17-6)18(16,12-3)13-8(11)14/h4,15H,1-3H3,(H3,11,12,13,14,16).
What are the key properties of [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea?
[[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea has a molecular weight of 295.36 g/mol, XLogP of 1.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-fluoro-5-(2-hydroxypropan-2-yl)thiophen-2-yl]-(methylamino)-oxo-λ6-sulfanylidene]urea is sourced from PubChem (CID 146617433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).