About CID 146617517
CID 146617517 (PubChem CID 146617517) has the molecular formula C21H28N5O3S-
and a molecular weight of 430.55 g/mol.
Molecular Properties
| Compound Name | CID 146617517 |
| PubChem CID | 146617517 |
| Molecular Formula | C21H28N5O3S- |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | — |
| SMILES | CC(C)n1cc(/[S-](=O)=N/C(=O)Nc2c3c(nc4c2CCC4(C)C)CCC3)c(CO)n1 |
| InChI | InChI=1S/C21H28N5O3S/c1-12(2)26-10-17(16(11-27)24-26)30(29)25-20(28)23-18-13-6-5-7-15(13)22-19-14(18)8-9-21(19,3)4/h10,12,27H,5-9,11H2,1-4H3,(H,22,23,28)/q-1 |
| InChIKey | WIPGXUPHZRXTCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 146617517 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146617517?
The IUPAC name of CID 146617517 (CID 146617517) is not available.
What is the SMILES notation for CID 146617517?
The canonical SMILES for CID 146617517 is CC(C)n1cc(/[S-](=O)=N/C(=O)Nc2c3c(nc4c2CCC4(C)C)CCC3)c(CO)n1.
What is the InChIKey of CID 146617517?
The InChIKey is WIPGXUPHZRXTCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N5O3S/c1-12(2)26-10-17(16(11-27)24-26)30(29)25-20(28)23-18-13-6-5-7-15(13)22-19-14(18)8-9-21(19,3)4/h10,12,27H,5-9,11H2,1-4H3,(H,22,23,28)/q-1.
What are the key properties of CID 146617517?
CID 146617517 has a molecular weight of 430.55 g/mol, XLogP of 3.80, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146617517 is sourced from PubChem (CID 146617517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).