About 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride
3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride (PubChem CID 146617588) has the molecular formula C8H8ClFO4S2
and a molecular weight of 286.73 g/mol. Its IUPAC name is 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
| PubChem CID | 146617588 |
| Molecular Formula | C8H8ClFO4S2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride |
| SMILES | CC1(c2cc(F)c(S(=O)(=O)Cl)s2)OCCO1 |
| InChI | InChI=1S/C8H8ClFO4S2/c1-8(13-2-3-14-8)6-4-5(10)7(15-6)16(9,11)12/h4H,2-3H2,1H3 |
| InChIKey | OHNCPUBIEQPSHN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride?
The IUPAC name of 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride (CID 146617588) is 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride.
What is the SMILES notation for 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride?
The canonical SMILES for 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride is CC1(c2cc(F)c(S(=O)(=O)Cl)s2)OCCO1.
What is the InChIKey of 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride?
The InChIKey is OHNCPUBIEQPSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClFO4S2/c1-8(13-2-3-14-8)6-4-5(10)7(15-6)16(9,11)12/h4H,2-3H2,1H3.
What are the key properties of 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride?
3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride has a molecular weight of 286.73 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-(2-methyl-1,3-dioxolan-2-yl)thiophene-2-sulfonyl chloride is sourced from PubChem (CID 146617588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).