C14H15Cl3N2O2 — CID 146617897
trichloromethyl N-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)carbamate (PubChem CID 146617897) has the molecular formula C14H15Cl3N2O2 and a molecular weight of 349.65 g/mol. Its IUPAC name is trichloromethyl N-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)carbamate.
| Compound Name | trichloromethyl N-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)carbamate |
|---|---|
| PubChem CID | 146617897 |
| Molecular Formula | C14H15Cl3N2O2 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | trichloromethyl N-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)carbamate |
| SMILES | CC1CCc2c1nc1c(c2NC(=O)OC(Cl)(Cl)Cl)CCC1 |
| InChI | InChI=1S/C14H15Cl3N2O2/c1-7-5-6-9-11(7)18-10-4-2-3-8(10)12(9)19-13(20)21-14(15,16)17/h7H,2-6H2,1H3,(H,18,19,20) |
| InChIKey | NZIODVXTOZMVJH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|