About 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine
4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine (PubChem CID 146618056) has the molecular formula C15H24FN
and a molecular weight of 237.36 g/mol. Its IUPAC name is 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine.
Molecular Properties
| Compound Name | 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine |
| PubChem CID | 146618056 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine |
| SMILES | CC(C)c1cnc(F)c(C(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C15H24FN/c1-9(2)11-8-17-14(16)12(10(3)4)13(11)15(5,6)7/h8-10H,1-7H3 |
| InChIKey | AKYSXODXGXMMHI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine?
The IUPAC name of 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine (CID 146618056) is 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine.
What is the SMILES notation for 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine?
The canonical SMILES for 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine is CC(C)c1cnc(F)c(C(C)C)c1C(C)(C)C.
What is the InChIKey of 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine?
The InChIKey is AKYSXODXGXMMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24FN/c1-9(2)11-8-17-14(16)12(10(3)4)13(11)15(5,6)7/h8-10H,1-7H3.
What are the key properties of 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine?
4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine has a molecular weight of 237.36 g/mol, XLogP of 4.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-fluoro-3,5-di(propan-2-yl)pyridine is sourced from PubChem (CID 146618056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).