C16H19Cl3N2O2 — CID 146618652
2,2,2-trichloroethyl N-(2,6-dicyclopropyl-3,5-dimethyl-4-pyridinyl)carbamate (PubChem CID 146618652) has the molecular formula C16H19Cl3N2O2 and a molecular weight of 377.70 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(2,6-dicyclopropyl-3,5-dimethyl-4-pyridinyl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(2,6-dicyclopropyl-3,5-dimethyl-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 146618652 |
| Molecular Formula | C16H19Cl3N2O2 |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2,2,2-trichloroethyl N-(2,6-dicyclopropyl-3,5-dimethyl-4-pyridinyl)carbamate |
| SMILES | Cc1c(C2CC2)nc(C2CC2)c(C)c1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H19Cl3N2O2/c1-8-12(21-15(22)23-7-16(17,18)19)9(2)14(11-5-6-11)20-13(8)10-3-4-10/h10-11H,3-7H2,1-2H3,(H,20,21,22) |
| InChIKey | GVSKLWHOLGAWBO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|