C18H23N7O2S — CID 146618815
1-[amino-oxo-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-λ6-sulfanylidene]-3-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)urea (PubChem CID 146618815) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[amino-oxo-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-λ6-sulfanylidene]-3-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)urea.
| Compound Name | 1-[amino-oxo-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-λ6-sulfanylidene]-3-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)urea |
|---|---|
| PubChem CID | 146618815 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[amino-oxo-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-λ6-sulfanylidene]-3-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)urea |
| SMILES | NS(=O)(=NC(=O)Nc1c2c(nc3c1CCC3)CCC2)c1cc2n(n1)CCNC2 |
| InChI | InChI=1S/C18H23N7O2S/c19-28(27,16-9-11-10-20-7-8-25(11)23-16)24-18(26)22-17-12-3-1-5-14(12)21-15-6-2-4-13(15)17/h9,20H,1-8,10H2,(H3,19,21,22,24,26,27) |
| InChIKey | ADIRZIAJIFXGFM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |