About imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane
imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane (PubChem CID 146618911) has the molecular formula C5H5F3N2OS2
and a molecular weight of 230.24 g/mol. Its IUPAC name is imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane.
Molecular Properties
| Compound Name | imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane |
| PubChem CID | 146618911 |
| Molecular Formula | C5H5F3N2OS2 |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C5H5F3N2OS2/c1-13(9,11)3-2-10-4(12-3)5(6,7)8/h2,9H,1H3 |
| InChIKey | AMOWTKFLEKKEDL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane?
The IUPAC name of imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane (CID 146618911) is imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane.
What is the SMILES notation for imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane?
The canonical SMILES for imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane is [H]N=S(C)(=O)c1cnc(C(F)(F)F)s1.
What is the InChIKey of imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane?
The InChIKey is AMOWTKFLEKKEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3N2OS2/c1-13(9,11)3-2-10-4(12-3)5(6,7)8/h2,9H,1H3.
What are the key properties of imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane?
imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane has a molecular weight of 230.24 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imino-methyl-oxo-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-λ6-sulfane is sourced from PubChem (CID 146618911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).