About (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane
(1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane (PubChem CID 146618953) has the molecular formula C15H23F3
and a molecular weight of 260.34 g/mol. Its IUPAC name is (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane.
Molecular Properties
| Compound Name | (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane |
| PubChem CID | 146618953 |
| Molecular Formula | C15H23F3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane |
| SMILES | CCC(/C(C)=C1/CCCC1C)=C(/C)CC(F)(F)F |
| InChI | InChI=1S/C15H23F3/c1-5-13(11(3)9-15(16,17)18)12(4)14-8-6-7-10(14)2/h10H,5-9H2,1-4H3/b13-11+,14-12- |
| InChIKey | NJEGJIBZQMFMAZ-KPGXXQICSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane?
The IUPAC name of (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane (CID 146618953) is (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane.
What is the SMILES notation for (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane?
The canonical SMILES for (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane is CCC(/C(C)=C1/CCCC1C)=C(/C)CC(F)(F)F.
What is the InChIKey of (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane?
The InChIKey is NJEGJIBZQMFMAZ-KPGXXQICSA-N. The full InChI is InChI=1S/C15H23F3/c1-5-13(11(3)9-15(16,17)18)12(4)14-8-6-7-10(14)2/h10H,5-9H2,1-4H3/b13-11+,14-12-.
What are the key properties of (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane?
(1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane has a molecular weight of 260.34 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-[(E)-3-ethyl-6,6,6-trifluoro-4-methylhex-3-en-2-ylidene]-2-methylcyclopentane is sourced from PubChem (CID 146618953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).