C20H22Cl2N2O4S — CID 146619146
1-[2-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-2,3-dihydroindol-3-yl]ethyl]pyrrolidin-2-ol (PubChem CID 146619146) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is 1-[2-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-2,3-dihydroindol-3-yl]ethyl]pyrrolidin-2-ol.
| Compound Name | 1-[2-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-2,3-dihydroindol-3-yl]ethyl]pyrrolidin-2-ol |
|---|---|
| PubChem CID | 146619146 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-[2-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-2,3-dihydroindol-3-yl]ethyl]pyrrolidin-2-ol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)N1CC(CCN2CCCC2O)c2ccccc21 |
| InChI | InChI=1S/C20H22Cl2N2O4S/c21-14-10-16(22)20(26)18(11-14)29(27,28)24-12-13(15-4-1-2-5-17(15)24)7-9-23-8-3-6-19(23)25/h1-2,4-5,10-11,13,19,25-26H,3,6-9,12H2 |
| InChIKey | CTIRXDBQJFSCST-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|