C24H26N6O — CID 1466192
3-benzyl-1-cyclopentyl-1-[(9-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]urea (PubChem CID 1466192) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-benzyl-1-cyclopentyl-1-[(9-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]urea.
| Compound Name | 3-benzyl-1-cyclopentyl-1-[(9-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 1466192 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3-benzyl-1-cyclopentyl-1-[(9-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]urea |
| SMILES | Cc1cccc2cc(CN(C(=O)NCc3ccccc3)C3CCCC3)c3nnnn3c12 |
| InChI | InChI=1S/C24H26N6O/c1-17-8-7-11-19-14-20(23-26-27-28-30(23)22(17)19)16-29(21-12-5-6-13-21)24(31)25-15-18-9-3-2-4-10-18/h2-4,7-11,14,21H,5-6,12-13,15-16H2,1H3,(H,25,31) |
| InChIKey | UMMUVTHJQURQOQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |