C14H10ClFN4OS2 — CID 146619262
N-(3-chloro-4-fluorophenyl)-2-methyl-5-(1,2-thiazol-3-yl)-1,2,6-thiadiazine-3-carboxamide (PubChem CID 146619262) has the molecular formula C14H10ClFN4OS2 and a molecular weight of 368.85 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-methyl-5-(1,2-thiazol-3-yl)-1,2,6-thiadiazine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-methyl-5-(1,2-thiazol-3-yl)-1,2,6-thiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 146619262 |
| Molecular Formula | C14H10ClFN4OS2 |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-methyl-5-(1,2-thiazol-3-yl)-1,2,6-thiadiazine-3-carboxamide |
| SMILES | CN1SN=C(c2ccsn2)C=C1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN4OS2/c1-20-13(7-12(19-23-20)11-4-5-22-18-11)14(21)17-8-2-3-10(16)9(15)6-8/h2-7H,1H3,(H,17,21) |
| InChIKey | RGADUXSYAAUOEC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|