C19H19ClFN5OS2 — CID 146619577
N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methylimidazol-4-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 146619577) has the molecular formula C19H19ClFN5OS2 and a molecular weight of 451.98 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methylimidazol-4-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methylimidazol-4-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 146619577 |
| Molecular Formula | C19H19ClFN5OS2 |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-methyl-5-[4-(1-methylimidazol-4-yl)thiophen-2-yl]-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1SNC(c2cc(-c3cn(C)cn3)cs2)CC1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClFN5OS2/c1-25-8-16(22-10-25)11-5-18(28-9-11)15-7-17(26(2)29-24-15)19(27)23-12-3-4-14(21)13(20)6-12/h3-6,8-10,15,17,24H,7H2,1-2H3,(H,23,27) |
| InChIKey | PLZCSAGQARQHRF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|