C22H28ClN3O7 — CID 146619640
(4S,5R,6S)-3-[[3-[(2-chloro-3,4-dihydroxybenzoyl)amino]propyl-methylamino]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 146619640) has the molecular formula C22H28ClN3O7 and a molecular weight of 481.93 g/mol. Its IUPAC name is (4S,5R,6S)-3-[[3-[(2-chloro-3,4-dihydroxybenzoyl)amino]propyl-methylamino]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[[3-[(2-chloro-3,4-dihydroxybenzoyl)amino]propyl-methylamino]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 146619640 |
| Molecular Formula | C22H28ClN3O7 |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (4S,5R,6S)-3-[[3-[(2-chloro-3,4-dihydroxybenzoyl)amino]propyl-methylamino]methyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(CN(C)CCCNC(=O)c3ccc(O)c(O)c3Cl)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C22H28ClN3O7/c1-10-13(18(22(32)33)26-17(10)15(11(2)27)21(26)31)9-25(3)8-4-7-24-20(30)12-5-6-14(28)19(29)16(12)23/h5-6,10-11,15,17,27-29H,4,7-9H2,1-3H3,(H,24,30)(H,32,33)/t10-,11+,15+,17+/m0/s1 |
| InChIKey | DQXUPXCMSDFYEW-WIILHCKQSA-N |
| XLogP | 1.00 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|