C17H19Cl2N3 — CID 146620195
(1S,2R,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-1,5-dichloroadamantane (PubChem CID 146620195) has the molecular formula C17H19Cl2N3 and a molecular weight of 336.27 g/mol. Its IUPAC name is (1S,2R,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-1,5-dichloroadamantane.
| Compound Name | (1S,2R,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-1,5-dichloroadamantane |
|---|---|
| PubChem CID | 146620195 |
| Molecular Formula | C17H19Cl2N3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (1S,2R,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-1,5-dichloroadamantane |
| SMILES | [N-]=[N+]=N[C@@H](c1ccccc1)[C@H]1[C@H]2C[C@H]3C[C@](Cl)(C2)C[C@@]1(Cl)C3 |
| InChI | InChI=1S/C17H19Cl2N3/c18-16-7-11-6-13(9-16)14(17(19,8-11)10-16)15(21-22-20)12-4-2-1-3-5-12/h1-5,11,13-15H,6-10H2/t11-,13-,14+,15-,16-,17-/m0/s1 |
| InChIKey | UFPMZUHFVDTJCP-CZVOBTNASA-N |
| XLogP | 5.83 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|