C75H47N5O — CID 146620661
3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-(3-phenylphenyl)-6-[9-(3-phenylphenyl)carbazol-3-yl]carbazole (PubChem CID 146620661) has the molecular formula C75H47N5O and a molecular weight of 1034.24 g/mol. Its IUPAC name is 3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-(3-phenylphenyl)-6-[9-(3-phenylphenyl)carbazol-3-yl]carbazole.
| Compound Name | 3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-(3-phenylphenyl)-6-[9-(3-phenylphenyl)carbazol-3-yl]carbazole |
|---|---|
| PubChem CID | 146620661 |
| Molecular Formula | C75H47N5O |
| Molecular Weight | 1034.24 g/mol |
| Exact Mass | 1033.38 |
| IUPAC Name | 3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9-(3-phenylphenyl)-6-[9-(3-phenylphenyl)carbazol-3-yl]carbazole |
| SMILES | c1ccc(-c2cccc(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5cc(-c7ccc8oc9c(-c%10nc(-c%11ccccc%11)nc(-c%11ccccc%11)n%10)cccc9c8c7)ccc5n6-c5cccc(-c6ccccc6)c5)ccc43)c2)cc1 |
| InChI | InChI=1S/C75H47N5O/c1-5-18-48(19-6-1)52-26-15-28-58(42-52)79-67-33-14-13-30-60(67)63-44-54(34-38-68(63)79)55-35-39-69-64(45-55)65-46-56(36-40-70(65)80(69)59-29-16-27-53(43-59)49-20-7-2-8-21-49)57-37-41-71-66(47-57)61-31-17-32-62(72(61)81-71)75-77-73(50-22-9-3-10-23-50)76-74(78-75)51-24-11-4-12-25-51/h1-47H |
| InChIKey | FTHRRADIOMFRPU-UHFFFAOYSA-N |
| XLogP | 19.63 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.24 |
| LogP ≤ 5 | 19.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |