About 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline
2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline (PubChem CID 146620903) has the molecular formula C17H13NS
and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline.
Molecular Properties
| Compound Name | 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline |
| PubChem CID | 146620903 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline |
| SMILES | C1=Cc2ccc(-c3cc4ccccc4s3)nc2CC1 |
| InChI | InChI=1S/C17H13NS/c1-3-7-14-12(5-1)9-10-15(18-14)17-11-13-6-2-4-8-16(13)19-17/h1-2,4-6,8-11H,3,7H2 |
| InChIKey | BXIUDVUOVJIYJL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline?
The IUPAC name of 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline (CID 146620903) is 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline.
What is the SMILES notation for 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline?
The canonical SMILES for 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline is C1=Cc2ccc(-c3cc4ccccc4s3)nc2CC1.
What is the InChIKey of 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline?
The InChIKey is BXIUDVUOVJIYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NS/c1-3-7-14-12(5-1)9-10-15(18-14)17-11-13-6-2-4-8-16(13)19-17/h1-2,4-6,8-11H,3,7H2.
What are the key properties of 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline?
2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline has a molecular weight of 263.37 g/mol, XLogP of 4.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzothiophen-2-yl)-7,8-dihydroquinoline is sourced from PubChem (CID 146620903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).