C25H29N7O2 — CID 146621478
(2E,4Z)-5-amino-N-[3-[4-(2,6-dimethylmorpholin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]-2-methyl-5-(methylideneamino)penta-2,4-dienamide (PubChem CID 146621478) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2E,4Z)-5-amino-N-[3-[4-(2,6-dimethylmorpholin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]-2-methyl-5-(methylideneamino)penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-amino-N-[3-[4-(2,6-dimethylmorpholin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]-2-methyl-5-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 146621478 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (2E,4Z)-5-amino-N-[3-[4-(2,6-dimethylmorpholin-4-yl)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]-2-methyl-5-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=N/C(N)=C\C=C(/C)C(=O)Nc1cccc(-c2nc(N3CC(C)OC(C)C3)c3[nH]ccc3n2)c1 |
| InChI | InChI=1S/C25H29N7O2/c1-15(8-9-21(26)27-4)25(33)29-19-7-5-6-18(12-19)23-30-20-10-11-28-22(20)24(31-23)32-13-16(2)34-17(3)14-32/h5-12,16-17,28H,4,13-14,26H2,1-3H3,(H,29,33)/b15-8+,21-9- |
| InChIKey | CAHVSSHBYDNWSA-QUOXALPVSA-N |
| XLogP | 3.62 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|