C31H32ClN6O3P — CID 146622297
5-chloro-4-N-(1-dimethylphosphorylnaphthalen-2-yl)-2-N-[2-methoxy-5-[2-(pyridin-3-ylmethylamino)ethoxy]phenyl]pyrimidine-2,4-diamine (PubChem CID 146622297) has the molecular formula C31H32ClN6O3P and a molecular weight of 603.06 g/mol. Its IUPAC name is 5-chloro-4-N-(1-dimethylphosphorylnaphthalen-2-yl)-2-N-[2-methoxy-5-[2-(pyridin-3-ylmethylamino)ethoxy]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(1-dimethylphosphorylnaphthalen-2-yl)-2-N-[2-methoxy-5-[2-(pyridin-3-ylmethylamino)ethoxy]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 146622297 |
| Molecular Formula | C31H32ClN6O3P |
| Molecular Weight | 603.06 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 5-chloro-4-N-(1-dimethylphosphorylnaphthalen-2-yl)-2-N-[2-methoxy-5-[2-(pyridin-3-ylmethylamino)ethoxy]phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(OCCNCc2cccnc2)cc1Nc1ncc(Cl)c(Nc2ccc3ccccc3c2P(C)(C)=O)n1 |
| InChI | InChI=1S/C31H32ClN6O3P/c1-40-28-13-11-23(41-16-15-34-19-21-7-6-14-33-18-21)17-27(28)37-31-35-20-25(32)30(38-31)36-26-12-10-22-8-4-5-9-24(22)29(26)42(2,3)39/h4-14,17-18,20,34H,15-16,19H2,1-3H3,(H2,35,36,37,38) |
| InChIKey | YNQQKXBDJBCZBR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.06 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|