C22H31FN2O3 — CID 146623650
4-[4-[2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-N-(3-hydroxypropyl)bicyclo[2.2.2]octane-1-carboxamide (PubChem CID 146623650) has the molecular formula C22H31FN2O3 and a molecular weight of 390.50 g/mol. Its IUPAC name is 4-[4-[2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-N-(3-hydroxypropyl)bicyclo[2.2.2]octane-1-carboxamide.
| Compound Name | 4-[4-[2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-N-(3-hydroxypropyl)bicyclo[2.2.2]octane-1-carboxamide |
|---|---|
| PubChem CID | 146623650 |
| Molecular Formula | C22H31FN2O3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-[4-[2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-N-(3-hydroxypropyl)bicyclo[2.2.2]octane-1-carboxamide |
| SMILES | NCC(=CF)COc1ccc(C23CCC(C(=O)NCCCO)(CC2)CC3)cc1 |
| InChI | InChI=1S/C22H31FN2O3/c23-14-17(15-24)16-28-19-4-2-18(3-5-19)21-6-9-22(10-7-21,11-8-21)20(27)25-12-1-13-26/h2-5,14,26H,1,6-13,15-16,24H2,(H,25,27) |
| InChIKey | UFFZNVJACMSEQE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|