C47H39BrN8O2 — CID 146624028
ethyl 5-[4-(10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide (PubChem CID 146624028) has the molecular formula C47H39BrN8O2 and a molecular weight of 827.79 g/mol. Its IUPAC name is ethyl 5-[4-(10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide.
| Compound Name | ethyl 5-[4-(10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide |
|---|---|
| PubChem CID | 146624028 |
| Molecular Formula | C47H39BrN8O2 |
| Molecular Weight | 827.79 g/mol |
| Exact Mass | 826.24 |
| IUPAC Name | ethyl 5-[4-(10,15,20-tripyridin-2-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide |
| SMILES | CCOC(=O)CCCC[n+]1ccc(-c2c3nc(c(-c4ccccn4)c4ccc([nH]4)c(-c4ccccn4)c4nc(c(-c5ccccn5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Br-] |
| InChI | InChI=1S/C47H38N8O2.BrH/c1-2-57-43(56)14-6-10-28-55-29-23-31(24-30-55)44-35-15-17-37(51-35)45(32-11-3-7-25-48-32)39-19-21-41(53-39)47(34-13-5-9-27-50-34)42-22-20-40(54-42)46(33-12-4-8-26-49-33)38-18-16-36(44)52-38;/h3-5,7-9,11-13,15-27,29-30H,2,6,10,14,28H2,1H3,(H,51,52,53,54);1H |
| InChIKey | JLGUOJVXHYNIPU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|