C18H23N3O2 — CID 146624257
(1S,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-5-methoxyadamantan-1-ol (PubChem CID 146624257) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1S,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-5-methoxyadamantan-1-ol.
| Compound Name | (1S,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-5-methoxyadamantan-1-ol |
|---|---|
| PubChem CID | 146624257 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (1S,3S,5S,7S)-2-[(R)-azido(phenyl)methyl]-5-methoxyadamantan-1-ol |
| SMILES | CO[C@@]12C[C@H]3C[C@@H](C1)C(C(N=[N+]=[N-])c1ccccc1)[C@](O)(C3)C2 |
| InChI | InChI=1S/C18H23N3O2/c1-23-17-8-12-7-14(10-17)15(18(22,9-12)11-17)16(20-21-19)13-5-3-2-4-6-13/h2-6,12,14-16,22H,7-11H2,1H3/t12-,14+,15?,16?,17+,18+/m1/s1 |
| InChIKey | NRZVANCMCQPXSQ-RGQLVHAJSA-N |
| XLogP | 3.99 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|