C41H40N2O3 — CID 146624385
(3S)-3-[1-[4-[2-[(2,6-dimethyl-4-pyridinyl)oxy]ethyl]phenyl]ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione (PubChem CID 146624385) has the molecular formula C41H40N2O3 and a molecular weight of 608.78 g/mol. Its IUPAC name is (3S)-3-[1-[4-[2-[(2,6-dimethyl-4-pyridinyl)oxy]ethyl]phenyl]ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[1-[4-[2-[(2,6-dimethyl-4-pyridinyl)oxy]ethyl]phenyl]ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146624385 |
| Molecular Formula | C41H40N2O3 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | (3S)-3-[1-[4-[2-[(2,6-dimethyl-4-pyridinyl)oxy]ethyl]phenyl]ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione |
| SMILES | Cc1cc(OCCc2ccc(C(C)[C@]3(C)CC(=O)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc2)cc(C)n1 |
| InChI | InChI=1S/C41H40N2O3/c1-29-26-37(27-30(2)42-29)46-25-24-32-20-22-33(23-21-32)31(3)40(4)28-38(44)43(39(40)45)41(34-14-8-5-9-15-34,35-16-10-6-11-17-35)36-18-12-7-13-19-36/h5-23,26-27,31H,24-25,28H2,1-4H3/t31?,40-/m0/s1 |
| InChIKey | RNKPAVRCDNDNPE-GZTWYVNDSA-N |
| XLogP | 8.18 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|