C22H20ClF3N6O — CID 146624852
1-[4-[7-[6-amino-3-(2,2,2-trifluoroethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 146624852) has the molecular formula C22H20ClF3N6O and a molecular weight of 476.89 g/mol. Its IUPAC name is 1-[4-[7-[6-amino-3-(2,2,2-trifluoroethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[6-amino-3-(2,2,2-trifluoroethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146624852 |
| Molecular Formula | C22H20ClF3N6O |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-[4-[7-[6-amino-3-(2,2,2-trifluoroethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3cc(-c4nc(N)ccc4CC(F)(F)F)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C22H20ClF3N6O/c1-2-19(33)31-5-7-32(8-6-31)21-15-9-16(23)14(10-17(15)28-12-29-21)20-13(11-22(24,25)26)3-4-18(27)30-20/h2-4,9-10,12H,1,5-8,11H2,(H2,27,30) |
| InChIKey | HFGIMMTYEYUURI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|